4-Nitrophenyl b-D-galactopyranoside
4-Nitrophenyl b-D-galactopyranoside is a biochemical compound used in the biomedicine industry. It acts as a substrate for the detection of β-galactosidase activity, a key enzyme involved in lactose metabolism. This compound is commonly used in assays to study the activation or inhibition of β-galactosidase in drug discovery and disease research, particularly for diseases that involve lactose intolerance or galactosemia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3150-24-1 |
| Pricing | Inquire |
| Cas | 3150-24-1 |
| Molecular Weight | 301.25 |
| Molecular Formula | C12H15NO8 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)O |