L-Tyrosine-(4-hydroxy-[18O])
L-Tyrosine-(4-hydroxy-[18O]) is the isotope form of L-Tyrosine, which is a non-essential amino acid and one of the 22 amino acids used in the synthesis of protein. It is derived from phenylalanine in human body and abundant in high-protein food products.
Supplier | BOC Sciences |
---|---|
Product # | BLP-001016 |
Pricing | Inquire |
Molecular Weight | 183.19 |
Molecular Formula | C9H11NO2[18O] |
Canonical SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |