Venlafaxine EP Impurity D
Venlafaxine EP Impurity D is an impurity of Venlafaxine, which is an antidepressant medication of the serotonin-norepinephrine reuptake inhibitor (SNRI) class used to treat major depressive disorder, generalized anxiety disorder, panic disorder, and social anxiety disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149289-30-5 |
| Pricing | Inquire |
| Cas | 149289-30-5 |
| Molecular Weight | 263.38 |
| Molecular Formula | C16H25NO2 |
| Canonical SMILES | CNCC(C1=CC=C(C=C1)OC)C2(CCCCC2)O |