2'-Deoxy-N-isobutyryl-5'-O-tritylguanosine
2'-Deoxy-N-isobutyryl-5'-O-tritylguanosine is a chemical compound used in the biomedical industry as a nucleotide analogue capable of inhibiting cancer cell growth by inducing apoptosis. It is also used as a building block in the synthesis of various oligonucleotides used in research for the treatment of cancer, viral infections and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 75759-63-6 |
| Pricing | Inquire |
| Cas | 75759-63-6 |
| Molecular Weight | 579.66 |
| Molecular Formula | C33H33N5O5 |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)O |