H4R antagonist 1
H4R antagonist 1, a potent and highly selective antagonist of histamine H4 receptor (H4R) with an IC50 of 27 nM, has no significant binding affinity for other histamine receptor subtypes H1R, H2R, and H3R.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1429375-54-1 |
| Pricing | Inquire |
| Cas | 1429375-54-1 |
| Molecular Weight | 335.16 |
| Molecular Formula | C11H11BrN8 |
| Canonical SMILES | CNC1CN(C1)C2=NC3=C(C=C(C=N3)Br)N4C2=NN=N4 |