(S,R,S)-AHPC-C4-NH2 dihydrochloride
(S,R,S)-AHPC-C4-NH2 dihydrochloride is a synthetic E3 ligand-linker conjugate containing a von-Hippel-Lindau (VHL) ligand based on (S,R,S)-AHPC and a C4 alkyl linker with terminal amine for covalent binding, which is an intermediate in the synthesis of a PROTAC degradation agent targeting EED.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-100127 |
| Pricing | Inquire |
| Cas | 2341796-78-7 |
| Molecular Weight | 602.62 |
| Molecular Formula | C₂₇H₄₁Cl₂N₅O₄S |
| Canonical SMILES | O=C(N[C@@H](C(C)(C)C)C(N1C[C@H](O)C[C@H]1C(NCC2=CC=C(C=C2)C3=C(C)N=CS3)=O)=O)CCCCN.Cl.Cl |