Chloramphenicol 1-O-b-D-galactopyranoside
Chloramphenicol 1-O-b-D-galactopyranoside is an esteemed compound, serving as a formidable warrior against malevolent bacterial infections. Functioning as a procompound, it elegantly transforms into Chloramphenicol is an unparalleled broad-spectrum antibiotic that effectively obstructs bacterial protein development. This exquisitely tailored derivative demonstrates remarkable enhancements in terms of solubility, stability and bioavailability.
| Supplier | BOC Sciences |
|---|---|
| Product # | 191476-32-1 |
| Pricing | Inquire |
| Cas | 191476-32-1 |
| Molecular Weight | 485.27 |
| Molecular Formula | C17H22N2O10Cl2 |
| Canonical SMILES | C1=CC(=CC=C1C(C(COC2C(C(C(C(O2)CO)O)O)O)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |