Rosuvastatin EP Impurity B (RR-Isomer)
Rosuvastatin EP Impurity B (RR-Isomer) is an impurity of Rosuvastatin, which is a statin medication used to prevent cardiovascular disease in those at high risk and treat abnormal lipids.
Supplier | BOC Sciences |
---|---|
Product # | 1094100-06-7 |
Pricing | Inquire |
Cas | 1094100-06-7 |
Molecular Weight | 481.54 |
Molecular Formula | C22H28FN3O6S |
Canonical SMILES | CC(C)C1=NC(=NC(=C1C=CC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C |