2-Chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
2-Chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a compound used in the biomedical industry for its potential in treating various diseases. Its precise role and efficacy depend on further research and studies. It may possess properties that could be beneficial in the development of drugs targeting specific conditions, but more investigation is required to determine its therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1241950-75-3 |
| Pricing | Inquire |
| Cas | 1241950-75-3 |
| Molecular Weight | 365.40 |
| Molecular Formula | C11H14BClINO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2Cl)I |