17b-Estradiol 3-O-benzyl 17-(2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester)
17b-Estradiol 3-O-benzyl 17-(2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester) is a specific estrogen steroid hormone derivative. It is commonly used as a reference standard in mass spectrometry for the research of estradiol related compounds related to gynecological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14364-98-8 |
| Pricing | Inquire |
| Cas | 14364-98-8 |
| Molecular Weight | 678.77 |
| Molecular Formula | C38H46O11 |
| Canonical SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)OC2CCC3C2(CCC4C3CCC5=C4C=CC(=C5)OCC6=CC=CC=C6)C)C(=O)OC)OC(=O)C |