Phenyl-6-azido-6-deoxy-2,3,4-tris-O-(phenylmethyl)-1-thio-b-D-galactopyranoside
Phenyl-6-azido-6-deoxy-2,3,4-tris-O-(phenylmethyl)-1-thio-b-D-galactopyranoside is a vital compound used in biomedicine for its potential applications in drug discovery and disease research. With its unique structure, it exhibits promising properties for investigating molecular interactions and enzymatic processes related to various biological mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 260976-50-9 |
| Pricing | Inquire |
| Cas | 260976-50-9 |
| Molecular Weight | 567.70 |
| Molecular Formula | C33H33N3O4S |
| Canonical SMILES | [N-]=[N+]=NCC1OC(SC=2C=CC=CC2)C(OCC=3C=CC=CC3)C(OCC=4C=CC=CC4)C1OCC=5C=CC=CC5 |