2-Methoxy-9-(β-D-ribofuranosyl)purine
2-Methoxy-9-(β-D-ribofuranosyl)purine, commonly known as a nucleoside analog, serves as a potent biomedicine primarily prescribed for combatting various cancerous conditions like leukemia and lymphoma. By intricately impeding DNA synthesis, this compound elegantly orchestrates the induction of apoptosis within malignant cells. The staggering potency of this therapeutic agent emanates from its remarkable capability to selectively target and disrupt enzymes and pathways involved in the aberrant proliferation of cancerous cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39638-84-1 |
| Pricing | Inquire |
| Cas | 39638-84-1 |
| Molecular Weight | 282.25 |
| Molecular Formula | C11H14N4O5 |
| Canonical SMILES | COC1=NC=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)O |