Quercetin 7-O-b-D-glucuronide
Quercetin 7-O-b-D-glucuronide is a well-known compound, holding immense application in the realm of disease research. Acting as a potent antioxidant, it showcases remarkable anti-inflammatory properties, thereby facilitating the research for an array of afflictions including cancer, cardiovascular disorders and neurodegenerative diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38934-20-2 |
| Pricing | Inquire |
| Cas | 38934-20-2 |
| Molecular Weight | 478.36 |
| Molecular Formula | C21H18O13 |
| Canonical SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)O)O)O |