Guanosine-5'-O-(1-Thiotriphosphate)
Guanosine-5'-O-(1-Thiotriphosphate) emerges as an indispensable compound within the biomedical industry serving as a substrate for diverse enzymatic reactions and a biophysical research instrument. Throughout investigations concerning GTP-binding proteins, signal transduction pathways and protein-protein interactions, its vital participation becomes apparent. Moreover, its utilization enables the exploration of key mechanisms involved in debilitating diseases, exemplified by cancer and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81570-50-5 |
| Pricing | Inquire |
| Cas | 81570-50-5 |
| Molecular Weight | 539.3 |
| Molecular Formula | C10H16N5O13P3S |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=S)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N |