O-(6-O-Acetyl-2-azide-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranosyl)-(1→4)-O-(methyl2,3-di-O-benzyl-β-D-glucopyranosyluronate)-(1→4)-2-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose
O-(6-O-Acetyl-2-azide-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranosyl)-(1→4)-O-(methyl2,3-di-O-benzyl-β-D-glucopyranosyluronate)-(1→4)-2-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose, a remarkable compound extensively utilized in the field of biomedicine, garners substantial attention due to its intricate nature and multifaceted properties. Its prominent role is witnessed in diverse pharmaceutical and biochemical investigations, primarily dedicated to formulating therapeutic strategies targeting specific ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99541-27-2 |
| Pricing | Inquire |
| Cas | 99541-27-2 |
| Molecular Weight | 1009.02 |
| Molecular Formula | C51H56N6O16 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2C(C(C(OC2C(=O)OC)OC3C4COC(O4)C(C3OC(=O)C)N=[N+]=[N-])OCC5=CC=CC=C5)OCC6=CC=CC=C6)N=[N+]=[N-])OCC7=CC=CC=C7)OCC8=CC=CC=C8 |