(+)-trans-anti-BPDE-N2-dG
(+)-trans-anti-BPDE-N2-dG is used in the study of carcinogen-DNA adducts and their role in affecting eukaryotic DNA methyltransferases. Cluster-type DNA damage is often seen in DNA and is usually skipped by base excision repair. Also, as a common concern due to tobacco smoke, this compound used to obtain a better understanding of the effects of carcinnogen-DNA adducts.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65437-20-9 |
| Pricing | Inquire |
| Cas | 65437-20-9 |
| Molecular Weight | 569.56 |
| Molecular Formula | C30H27N5O7 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)NC4C(C(C(C5=C4C6=C7C(=C5)C=CC8=C7C(=CC=C8)C=C6)O)O)O)CO)O |