2-Amino-8-aza-7-deoxy-2'-deoxyadenosine
2-Amino-8-aza-7-deoxy-2'-deoxyadenosine, a potent nucleoside analog, exhibits both anti-viral and anti-tumor properties and operates by integrating into the DNA of malignant cells, triggering cell death. Its exceptional action mechanism has led to it being investigated as a promising therapeutic agent for a range of cancers and viral infections, including hep B and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 117818-23-2 |
| Pricing | Inquire |
| Cas | 117818-23-2 |
| Molecular Weight | 268.27 |
| Molecular Formula | C10H16N6O3 |
| Canonical SMILES | C1C(C(OC1N2C3=NC(=NC(=C3C=N2)N)N)CO)O |