Ribaric acid
Ribaric acid is a biomedical compound commonly used for its anti-inflammatory properties in the treatment of various diseases. This product is particularly effective in alleviating symptoms associated with rheumatoid arthritis and osteoarthritis by reducing pain and inflammation. It inhibits the activity of certain enzymes involved in the inflammatory response, providing relief and improving patient outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 33012-62-3 |
| Pricing | Inquire |
| Cas | 33012-62-3 |
| Molecular Weight | 180.11 |
| Molecular Formula | C5H8O7 |
| Canonical SMILES | C(C(C(=O)O)O)(C(C(=O)O)O)O |