2',3',5'-Tri-O-acetyl-N3-methyluridine
2',3',5'-Tri-O-acetyl-N3-methyluridine is a pharmaceutical compound widely used in the biomedical industry. It plays a crucial role in the research of various diseases, such as cancer and viral infections. This compound exhibits potent antitumor activity by inhibiting cell growth and inducing apoptosis. Additionally, it is utilized in the development of antiviral therapies against RNA viruses due to its ability to interfere with viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64623-26-3 |
| Pricing | Inquire |
| Cas | 64623-26-3 |
| Molecular Weight | 384.34 |
| Molecular Formula | C16H20N2O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=CC(=O)N(C2=O)C)OC(=O)C)OC(=O)C |