Fosinopril-[d5] Sodium Salt
Fosinopril-[d5] Sodium Salt is the labelled analogue of Fosinopril, which is an angiotensin converting enzyme inhibitor used for the treatment of hypertension and some types of chronic heart failure.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005505 |
| Pricing | Inquire |
| Cas | 1217513-43-3 |
| Molecular Weight | 590.68 |
| Molecular Formula | C30H40D5NNaO7P |
| Canonical SMILES | CCC(=O)OC(C(C)C)OP(=O)(CCCCC1=CC=CC=C1)CC(=O)N2CC(CC2C(=O)[O-])C3CCCCC3.[Na+] |