N4-Acetyl-5'-O-tert-butyldimethylsilylcytidine
N4-Acetyl-5'-O-tert-butyldimethylsilylcytidine is utilized as a key component for research and development related to antiviral drugs. It plays a role in the research of various viral infections, supporting the design and development of innovative antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 119794-51-3 |
| Pricing | Inquire |
| Cas | 119794-51-3 |
| Molecular Weight | 399.51 |
| Molecular Formula | C17H29N3O6Si |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2C(C(C(O2)CO[Si](C)(C)C(C)(C)C)O)O |