CD73-IN-1
CD73-IN-11 is a CD73 inhibitor with an IC50 of ≤316.23 nM for the human enzyme in a cell-free assay. It can be used in cancer treatment. (Extracted from patent WO 2017153952 A1, example 80)
| Supplier | BOC Sciences |
|---|---|
| Product # | 2132396-40-6 |
| Pricing | Inquire |
| Cas | 2132396-40-6 |
| Molecular Weight | 371.41 |
| Molecular Formula | C18H17N3O4S |
| Canonical SMILES | C1CC1C2=CC3=C(N2)C=C(C=C3)NS(=O)(=O)C4=CC(=C(C=C4)O)C(=O)N |