2'-Deoxy-4'-thioadenosine
2’-Deoxy-4’-thioadenosine is a paramount biochemical compound extensively characterized by its profound inhibitory prowess upon enzymes engaged in pivotal metabolic pathways. With its idiosyncratic attributes, it assuming indispensability as a primary instrument in the realm of biomedical examination and pharmacological advancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135656-35-8 |
| Pricing | Inquire |
| Cas | 135656-35-8 |
| Molecular Weight | 267.31 |
| Molecular Formula | C10H13N5O2S |
| Canonical SMILES | C1C(C(SC1N2C=NC3=C(N=CN=C32)N)CO)O |