PD 150606
PD 150606 is a selective, cell-permeable inhibitor of calpains (Ki = 0.21 μM for μ-calpain (calpain-1) and 0.37 μM for m-calpain (calpain-2)). It targets the calcium binding sites of calpain. PD 150606 demonstrates high specificity for calpains relative to other proteases, and is a non-competitive inhibitor with respect to the substrate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 179528-45-1 |
| Pricing | Inquire |
| Cas | 179528-45-1 |
| Molecular Weight | 306.12 |
| Molecular Formula | C9H7IO2S |
| Canonical SMILES | C1=CC(=CC=C1C=C(C(=O)O)S)I |