Scutellarein 7-methyl ether
Scutellarein 7-methyl ether is an immensely powerful constituent detected in diverse plants exhibiting its application within the research of natural compound as an indispensable catalyst for the development of anti-inflammatory, osteoprotective and anticancerous drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23130-22-5 |
| Pricing | Inquire |
| Cas | 23130-22-5 |
| Molecular Weight | 300.26 |
| Molecular Formula | C16H12O6 |
| Canonical SMILES | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O)O |