6-Bromo-2-naphthyl b-D-glucuronide
6-Bromo-2-naphthyl b-D-glucuronide, an invaluable compound extensively employed in the biomedical sector, serves as a pivotal substrate for diverse drug-metabolizing enzymes, thereby facilitating intricate investigations into the realm of drug metabolism. It confers great insights into drug interactions and sheds light on the intricate pathways involved in drug metabolism. Moreover, its application in hepatic disease research unveils the intricate mechanisms underlying hepatic drug processing and elimination.
| Supplier | BOC Sciences |
|---|---|
| Product # | 22720-35-0 |
| Pricing | Inquire |
| Cas | 22720-35-0 |
| Molecular Weight | 399.20 |
| Molecular Formula | C16H15BrO7 |
| Canonical SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1OC3C(C(C(C(O3)C(=O)O)O)O)O |