Methyl 3-O-(b-D-galactopyranosyl)-b-D-galactopyranoside
Methyl 3-O-(b-D-galactopyranosyl)-b-D-galactopyranoside is a vital compound used in biomedical research. It is commonly employed as a substrate to investigate various enzymes and their interactions. With its unique chemical structure, this compound plays a significant role in studying drug therapies for diseases related to carbohydrate metabolism disorders and galactosemia.
Supplier | BOC Sciences |
---|---|
Product # | 81131-46-6 |
Pricing | Inquire |
Cas | 81131-46-6 |
Molecular Weight | 356.32 |
Molecular Formula | C13H24O11 |
Canonical SMILES | COC1C(C(C(C(O1)CO)O)OC2C(C(C(C(O2)CO)O)O)O)O |