2,5-Dimethylphenylzinc iodide solution
As a pharmaceutical intermediate, 2,5-Dimethylphenylzinc iodide solution is mainly used in the synthesis of complex organic compounds. As a Grignard reagent, the solution facilitates the synthesis of therapeutic compounds designed to combat a variety of diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312692-96-9 |
| Pricing | Inquire |
| Cas | 312692-96-9 |
| Molecular Weight | 297.45 |
| Molecular Formula | (CH3)2C6H3Znl |
| Canonical SMILES | CC1=C[C-]=C(C=C1)C.[Zn+]I |