7-Hydroxycoumarin-3-carboxylic acid N-succinimidyl ester
7-Hydroxycoumarin-3-carboxylic acid N-succinimidyl ester is an indispensable reagent in the biomedical field and showcases its versatility through its widespread use in crucial applications such as antibody labeling, protein conjugation, and immunoassay analysis. Known for its exceptional stability and fluorescence properties, this compound enables precise and reliable detection and quantification of a variety of drugs, biomarkers, and diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 134471-24-2 |
| Pricing | Inquire |
| Cas | 134471-24-2 |
| Molecular Weight | 303.22 |
| Molecular Formula | C14H9NO7 |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC3=C(C=C(C=C3)O)OC2=O |