5- (4, 4, 5, 5- Tetramethyl- 1, 3, 2- dioxaborolan- 2- yl) - 1- [[2- (trimethylsilyl) ethoxy] methyl] -1H- imidazole
5- (4, 4, 5, 5- Tetramethyl- 1, 3, 2- dioxaborolan- 2- yl) - 1- [[2- (trimethylsilyl) ethoxy] methyl] -1H- imidazole can be involved in preparation of pyrazolo[1,5-a]pyrimidine compounds as mTOR inhibitors useful in treating cancer.
Supplier | BOC Sciences |
---|---|
Product # | BB076775 |
Pricing | Inquire |
Cas | 1319255-50-9 |
Molecular Weight | 324.3 |
Molecular Formula | C15H29BN2O3Si |
Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CN2COCC[Si](C)(C)C |