4,6-O-Benzylidene-1-O-(N-Cbz-3-aminopropyl)-b-D-galactopyranose
4,6-O-Benzylidene-1-O-(N-Cbz-3-aminopropyl)-b-D-galactopyranose, a critical compound employed in pharmaceutical and biomedicine advancement, assumes a pivotal function in the formulation of drugs against diverse afflictions. Thanks to its distinctive configuration, it has the potential to serve in the therapy of precise ailments, selective receptor targeting, and drug conveyance mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 189819-33-8 |
| Pricing | Inquire |
| Cas | 189819-33-8 |
| Molecular Weight | 459.49 |
| Molecular Formula | C24H29NO8 |
| Canonical SMILES | C1C2C(C(C(C(O2)OCCCNC(=O)OCC3=CC=CC=C3)O)O)OC(O1)C4=CC=CC=C4 |