N,N-Dimethyl-N-(2-acryoyloxyethyl)-N-(3-sulfopropyl)-ammonium betaine
N,N-Dimethyl-N-(2-acryoyloxyethyl)-N-(3-sulfopropyl)-ammonium betaine has great potential in disease modification, drug delivery systems, and biomedical research. It has unparalleled capabilities as a stabilizer, particularly in the field of drugs targeting the fields of neuroscience and oncology.
| Supplier | BOC Sciences |
|---|---|
| Product # | 88992-91-0 |
| Pricing | Inquire |
| Cas | 88992-91-0 |
| Molecular Weight | 265.33 |
| Molecular Formula | C10H19NO5S |
| Canonical SMILES | C[N+](C)(CCCS(=O)(=O)[O-])CCOC(=O)C=C |