Methylenedisalicylic acid
Methylenedisalicylic acid is an unparalleled anti-inflammatory substance that effectively blocks the production of prostaglandins and leukotrienes, bringing hope to the fields of rheumatoid arthritis, asthma and various puzzling inflammatory abnormalities that plague humans.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27496-82-8 |
| Pricing | Inquire |
| Cas | 27496-82-8 |
| Molecular Weight | 288.26 |
| Molecular Formula | C15H12O6 |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)O)OCOC2=CC=CC=C2C(=O)O |