(4-Benzylpiperidin-4-yl)methanol Hydrochloride
(4-Benzylpiperidin-4-yl)methanol Hydrochloride is a salt analog of (4-Benzylpiperidin-4-yl)methanol (CAS# 546085-37-4), which can be used in the synthesis of sulfamides, sulfamates and sulfonamides. (4-Benzylpiperidin-4-yl)methanol Hydrochloride may also be useful in the preparation of substituted pyrazolo[1,5-a]pyridine compounds as ret kinase inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB071169 |
| Pricing | Inquire |
| Cas | 1795189-20-6 |
| Molecular Weight | 205.30 + 36.46 |
| Molecular Formula | C13H19NO·HCl |
| Canonical SMILES | C1CNCCC1(CC2=CC=CC=C2)CO.Cl |