2,3,4,6-Tetra-O-acetyl-b-D-mannopyranosyl azide
2,3,4,6-Tetra-O-acetyl-b-D-mannopyranosyl azide is a vital compound used in biomedicine for its role in the development of glycoconjugates. It serves as a reliable precursor for synthesizing azide-labeled carbohydrates, which are extensively utilized in bioorthogonal chemistry and glycobiology research. Through advanced applications like click chemistry, this compound assists in studying various diseases, such as cancer and infectious diseases, by enabling selective labeling and visualization of glycoconjugates in biological systems.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65864-60-0 |
| Pricing | Inquire |
| Cas | 65864-60-0 |
| Molecular Weight | 373.32 |
| Molecular Formula | C14H19N3O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |