HPI 1
HPI 1 is a hedgehog (Hh) signaling inhibitor that blocks Sonic hedgehog (Shh)-, SAG- and Gli-induced Hh pathway activation in Shh-LIGHT2 cells (IC50 = 1.5, 1.5, 4 and 6 μM for Shh-, SAG-, Gli2- and Gli1-induced activation) with no effect on Wnt signaling. HPI 1 also inhibits Hh pathway activation in SmoM2-LIGHT cells (IC50 = 2.5 μM), and prevents the proliferation of cerebellar granule neuron precursors expressing SmoM2.
| Supplier | BOC Sciences |
|---|---|
| Product # | 599150-20-6 |
| Pricing | Inquire |
| Cas | 599150-20-6 |
| Molecular Weight | 463.52 |
| Molecular Formula | C27H29NO6 |
| Canonical SMILES | CC1=C(C(C2=C(N1)CC(CC2=O)C3=CC=CC=C3OC)C4=CC(=CC=C4)O)C(=O)OCCOC |