(-)-Phaselic acid
(-)-Phaselic acid is a natural compound found in various plants exhibiting antioxidant and anti-inflammatory properties, making it a promising candidate for the research of oxidative stress-related diseases such as cardiovascular disorders and neurodegenerative conditions. Additionally, (-)-Phaselic acid has demonstrated antimicrobial activity, suggesting its potential in the development of novel anti-infective drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4419 |
| Pricing | Inquire |
| Cas | 423170-79-0 |
| Molecular Weight | 296.23 |
| Molecular Formula | C13H12O8 |
| Canonical SMILES | C1=CC(=C(C=C1C=CC(=O)OC(CC(=O)O)C(=O)O)O)O |