Methyl 2-O-(a-D-mannopyranosyl)-a-D-mannopyranoside
Methyl 2-O-(α-D-mannopyranosyl)-α-D-mannopyranoside is an indispensable biomedical tool employed in investigating intricate carbohydrate-protein interactions. With its efficacy as a glycosylation reagent, it plays a pivotal role in comprehending diverse diseases, thereby aiding in drug discovery, vaccine development, and therapeutic strategies pertaining to carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 59571-75-4 |
| Pricing | Inquire |
| Cas | 59571-75-4 |
| Molecular Weight | 356.32 |
| Molecular Formula | C13H24O11 |
| Canonical SMILES | COC1C(C(C(C(O1)CO)O)O)OC2C(C(C(C(O2)CO)O)O)O |