WAY 213613
WAY 213613 is a potent and non-substrate inhibitor of EAAT2 (GLT-1), displaying > 44-fold selectivity over EAAT1 and EAAT3 (IC50 = 85, 3787 and 5004 nM for EAAT2, EAAT3 and EAAT1, respectively). WAY 213613 exhibits no activity towards ionotropic and metabotropic glutamate receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 868359-05-1 |
| Pricing | Inquire |
| Cas | 868359-05-1 |
| Molecular Weight | 415.19 |
| Molecular Formula | C16H13BrF2N2O4 |
| Canonical SMILES | C1=CC(=CC=C1NC(=O)CC(C(=O)O)N)OC2=CC(=C(C=C2Br)F)F |