Hydroxyzine-[d4] Dihydrochloride
Hydroxyzine-[d4] Dihydrochloride is the labelled salt of Hydroxyzine, which is a histamine H1 receptor antagonist with an anti-allergic property. It is used to treat chronic urticaria, dermatitis and other inflammations.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011588 |
| Pricing | Inquire |
| Cas | 1219805-91-0 |
| Molecular Weight | 451.86 |
| Molecular Formula | C21H25D4Cl3N2O2 |
| Canonical SMILES | C1CN(CCN1CCOCCO)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |