PROTAC Bcl2 degrader-1
PROTAC Bcl2 degrader-1, a PROTAC based on Cereblon ligand, potently and selectively induces the degradation of Bcl-2 (IC50 = 4.94 μM, DC50 = 3.0 μM) and Mcl-1 (IC50 = 11.81 μM) by introducing the E3 ligase cereblon (CRBN)-binding ligand pomalidomide to Mcl-1/Bcl-2 dual inhibitor Nap-1.
Supplier | BOC Sciences |
---|---|
Product # | 2378801-85-3 |
Pricing | Inquire |
Cas | 2378801-85-3 |
Molecular Weight | 941.84 |
Molecular Formula | C45H45BrN6O10S |
Canonical SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCOCCOCCNC(=O)CCCCC(=O)NCCN4C(=O)C5=C6C(=C(C=C5)SC7=CC=C(C=C7)Br)C=CC=C6C4=O |