D-Sedoheptulose-7-phosphate barium salt
D-Sedoheptulose-7-phosphate barium salt is an essential biomedical agent, emerging as a pivotal catalyst across multifarious ailments. Embracing an indispensible role in the intricate orchestration of metabolic pathways and carbohydrate metabolism, its application extends to the research of enigmatic conditions like diabetes, metabolic syndrome, and glycolysis-related afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17187-72-3 |
| Pricing | Inquire |
| Cas | 17187-72-3 |
| Molecular Weight | 425.47 |
| Molecular Formula | C7H13O10PBa |
| Canonical SMILES | C(C1C(C(C(C(O1)(CO)O)O)O)O)OP(=O)([O-])[O-].[Ba+2] |