3-O-Acetyloleanderolide
3-O-Acetyloleanderolide is a natural compound used in the development of drugs targeting cancer, inflammation and neurodegenerative disorders. This natural compound exhibits strong anti-inflammatory effects, making it a potential research option for autoimmune diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6646 |
| Pricing | Inquire |
| Cas | 62498-83-3 |
| Molecular Weight | 514.7 |
| Molecular Formula | C32H50O5 |
| Canonical SMILES | CC(=O)OC1CCC2(C(C1(C)C)CCC3(C2CC(C45C3(CCC6(C4CC(CC6)(C)C)C(=O)O5)C)O)C)C |