alfa-Amyrin Acetate
Alpha-Amyrin acetate is a natural triterpenoid found in the herbs of Ervatamia divaricata, it can decrease blood engorgement time and feeding rate and decline fecundity which reduce the overall survival and reproductive capacity of the malaria vector A. stephensi. Alpha-Amyrin acetate also exhibits the activities of anti-inflammatory and antispasmodic.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6297 |
| Pricing | Inquire |
| Cas | 863-76-3 |
| Molecular Weight | 468.8 |
| Molecular Formula | C32H52O2 |
| Canonical SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC(=O)C)C)C)C2C1C)C)C |