Difelikefalin acetate
| Supplier | Creative Peptides |
|---|---|
| Product # | 10-101-174 |
| CAS # | 1024829-44-4 |
| Pricing | Inquire |
| LabelingTarget | K-opioid receptor |
| Synonyms | CR845 acetate;CR-845 acetate;UNII-0P70AR5BYB; 0P70AR5BYB; |
| MolecularFormula | C38H57N7O8 |
| MolecularWeight | 739.90128 |
| Source | Synthetic |
| Storage | -20°C |
| Explanation | Difelikefalin ,also known as D-Phe-D-Phe-D-Leu-D-Lys-[γ-(4-N-piperidinyl)amino carboxylic acid] (as the acetate salt), is an analgesic opioid peptide acting as a peripherally specific, highly selective agonist of the κ-opioid receptor (KOR). |
| Application | Difelikefalin is an intravenous agent for the treatment of postoperative pain. |
| Activity | Agonist |
| InChI | InChI=1S/C36H53N7O6.C2H4O2/c1-24(2)21-29(32(45)40-28(15-9-10-18-37)34(47)43-19-16-36(39,17-20-43)35(48)49)42-33(46)30(23-26-13-7-4-8-14-26)41-31(44)27(38)22-25-11-5-3-6-12-25;1-2(3)4/h3-8,11-14,24,27-30H,9-10,15-23,37-39H2,1-2H3,(H,40,45)(H,41,44)(H,42,46)(H,48,49);1H3,(H,3,4)/t27-,28-,29-,30-;/m1./s1 |
| InChIKey | MZWHRPKAHCWTOI-KGURMGBCSA-N |
| IsomericSMILES | CC(C)C[C@H](C(=O)N[C@H](CCCCN)C(=O)N1CCC(CC1)(C(=O)O)N)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)[C@@H](CC3=CC=CC=C3)N.CC(=O)O |
| BiologicalActivity | Difelikefalin acetate is a kappa opiate receptor agonist that is used for its antipruritic effects. |
| AreasOfInterest | Postoperative pain |
| Disease | Acute Pain and Postoperative Pain |