5'-O-DMTr-3'-β-OH-5-Me-dU(Boc)
5'-O-DMTr-3'-β-OH-5-Me-dU(Boc) is a modified deoxyribonucleoside where a dimethoxytrityl (DMTr) group is attached to the 5'-hydroxyl, a β-hydroxyl group is at the 3' position, and a methyl group is at the 5' position of uridine (5-Me-dU). Additionally, a tert-butoxycarbonyl (Boc) group protects the uracil base. This compound is utilized in the synthesis of DNA oligonucleotides, offering enhanced protection and stability. It is particularly useful in nucleic acid research and therapeutic developments, facilitating efficient coupling reactions during solid-phase synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00708 |
| Pricing | Inquire |
| Cas | 2155800-37-4 |
| Molecular Weight | 644.72 |
| Molecular Formula | C36H40N2O9 |
| Canonical SMILES | O=C(OC(C)(C)C)N1C(=O)C(=CN(C1=O)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2)C |