2-Chloroethyl-b-D-fructopyranoside
2-Chloroethyl-b-D-fructopyranoside, a biochemical compound frequently employed in the biomedical sector, exhibits considerable promise for the amelioration of various ailments, most notably cancer. With its distinctive attributes, this compound emerges as a compelling contender for targeted drug conveyance techniques, specifically designed to selectively target malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84543-36-2 |
| Pricing | Inquire |
| Cas | 84543-36-2 |
| Molecular Weight | 242.65 |
| Molecular Formula | C8H15ClO6 |
| Canonical SMILES | C1C(C(C(C(O1)(CO)OCCCl)O)O)O |