N-1-Naphthalenyl-2-[(3-thienylcarbonyl)amino]-4-thiazoleacetamide
N-1-Naphthalenyl-2-[(3-thienylcarbonyl)amino]-4-thiazoleacetamide is derived from ethyl 2-amino-4-thiaxolacetate (E899330) and 1-naphthylamine (N378015). Ethyl 2-amino-4-thiaxolacetate is used in the synthesis of various pharmaceutical and biologically active compounds including inhibitors and antibiotics and 1-naphthylamine is a commonly used reagent that is used to produce various dyes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058823 |
| Pricing | Inquire |
| Cas | 1209852-34-5 |
| Molecular Weight | 393.48 |
| Molecular Formula | C20H15N3O2S2 |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)CC3=CSC(=N3)NC(=O)C4=CSC=C4 |