L-Valine-N-Fmoc-[1-13C]
L-Valine-N-Fmoc-[1-13C] is a 13C labelled analogue of Fmoc-valine. Fmoc-valine is a sterically hindered, Fmoc-protected amino acid and is a derivative of L-Valine. Fmoc-valine is commonly used to synthesize 4-thiazolidinones and 4-metathiazanones as well.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-009570 |
| Pricing | Inquire |
| Cas | 286460-74-0 |
| Molecular Weight | 340.38 |
| Molecular Formula | C19[13C]H21NO4 |
| Canonical SMILES | CC(C)C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |