(R)-(+)-Corypalmine
(R)-(+)-Corypalmine, an alkaloid of natural origin, possesses potent antinociceptive and anti-inflammatory properties, rendering it a potential therapeutic agent for alleviating pain and inflammation. Experimental studies have verified its efficacy in managing pain, while also highlighting its potential in treating sleep apnea and schizophrenia, neurological conditions that have proven challenging to manage with conventional medications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6018-39-9 |
| Pricing | Inquire |
| Cas | 6018-39-9 |
| Molecular Weight | 341.40 |
| Molecular Formula | C20H23NO4 |
| Canonical SMILES | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)O)OC)C=C1)OC |